Products Categories
| CAS No.: | 2051-96-9 |
|---|---|
| Name: | Benzyl lactate |
| Molecular Structure: | |
|
|
|
| Formula: | C10H12O3 |
| Molecular Weight: | 180.203 |
| Synonyms: | Lacticacid, benzyl ester (7CI,8CI);Benzyl 2-hydroxypropionate;NSC 72745;Phenylmethyl 2-hydroxypropanoate; |
| EINECS: | 218-136-6 |
| Density: | 1.15 g/cm3 |
| Melting Point: | 41-42 °C |
| Boiling Point: | 280.5 °C at 760 mmHg |
| Flash Point: | 116.8 °C |
| Appearance: | Yellowish liquid Colorless to yellowish liquid |
| PSA: | 46.53000 |
| LogP: | 1.11060 |
Product Name: Benzyl lactate (CAS NO.2051-96-9)

Molecular Formula: C10H12O3
Molecular Weight: 180.2g/mol
Mol File: 2051-96-9.mol
Einecs: 218-136-6
Appearance: Yellowish liquid Colorless to yellowish liquid
Boiling point: 280.5 °C at 760 mmHg
Flash Point: 116.8 °C
Density: 1.15 g/cm3
Surface Tension: 43.5 dyne/cm
Enthalpy of Vaporization: 54.84 kJ/mol
Vapour Pressure: 0.0018 mmHg at 25°C
XLogP3-AA: 1.4
H-Bond Donor: 1
H-Bond Acceptor: 3
Structure Descriptors of Benzyl lactate (CAS NO.2051-96-9):
IUPAC Name: benzyl 2-hydroxypropanoate
Canonical SMILES: CC(C(=O)OCC1=CC=CC=C1)O
InChI: InChI=1S/C10H12O3/c1-8(11)10(12)13-7-9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3
InChIKey: ZYTLPUIDJRKAAM-UHFFFAOYSA-N
Benzyl lactate ,its CAS NO. is 2051-96-9,the synonyms is AI3-15720 ; EINECS 218-136-6 ; Propanoic acid, 2-hydroxy-, phenylmethyl ester .