18503-89-4 Usage
Description
1,1-Diisopropoxytrimethylamine is an organic compound with the chemical formula (CH3)3N+[CH(CH3)2]2O-. It is a colorless liquid that is soluble in water and has a characteristic amine-like odor. 1,1-Diisopropoxytrimethylamine is known for its reactivity and is often used as a reagent in various chemical reactions.
Uses
Used in Pharmaceutical Industry:
1,1-Diisopropoxytrimethylamine is used as a reagent for the synthesis of various pharmaceutical compounds. Its ability to participate in a wide range of chemical reactions makes it a valuable tool in the development of new drugs and medications.
Used in Analytical Chemistry:
1,1-Diisopropoxytrimethylamine is used as a derivatizing agent in the quantification of certain compounds, such as cocaine and its metabolite, benzoyl ecgonine, from urine matrix. Its reactivity allows for the conversion of target analytes into more easily detectable and quantifiable forms, enhancing the accuracy and reliability of analytical results.
Check Digit Verification of cas no
The CAS Registry Mumber 18503-89-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,8,5,0 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 18503-89:
(7*1)+(6*8)+(5*5)+(4*0)+(3*3)+(2*8)+(1*9)=114
114 % 10 = 4
So 18503-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H21NO2/c1-7(2)11-9(10(5)6)12-8(3)4/h7-9H,1-6H3