5952-92-1 Usage
Uses
Used in Pharmaceutical Industry:
1-Methyl-1H-pyrazole-4-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and properties, contributing to the development of new drugs with potential therapeutic applications.
Used in Agricultural Industry:
In agriculture, 1-Methyl-1H-pyrazole-4-carboxylic acid is utilized as a key intermediate in the production of agrochemicals, aiding in the development of effective compounds for crop protection and enhancement of agricultural yields.
Used in Materials Science:
1-Methyl-1H-pyrazole-4-carboxylic acid is employed in materials science for the synthesis of novel materials with specific properties, such as those with potential applications in coatings, adhesives, or other industrial materials, leveraging its chemical reactivity and structural characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 5952-92-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,5 and 2 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5952-92:
(6*5)+(5*9)+(4*5)+(3*2)+(2*9)+(1*2)=121
121 % 10 = 1
So 5952-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2/c1-7-3-4(2-6-7)5(8)9/h2-3H,1H3,(H,8,9)/p-1
