7435-83-8 Usage
Uses
Used in Chemical Synthesis:
2,3,5,6-Tetramethylbenzyl chloride is used as an intermediate in the chemical synthesis industry for the production of various industrial chemicals. Its unique structure allows it to be a key component in the creation of a range of compounds, enhancing the versatility and applicability of the final products.
Used in Pharmaceutical Production:
In the pharmaceutical sector, 2,3,5,6-Tetramethylbenzyl chloride is utilized as an intermediate for the synthesis of pharmaceuticals. Its role in drug development is crucial, as it contributes to the formation of active pharmaceutical ingredients, thereby playing a part in the creation of new medicines.
Used in Organic Synthesis as a Reagent:
2,3,5,6-Tetramethylbenzyl chloride also serves as a reagent in organic synthesis, where it is employed to facilitate specific chemical reactions. Its reactivity and structural properties make it a valuable tool in the synthesis of complex organic compounds, broadening the scope of organic chemistry research and development.
Used in Research and Development:
In research and development settings, 2,3,5,6-Tetramethylbenzyl chloride is used as a building block for the synthesis of new organic compounds. Its application in this field is instrumental in advancing scientific knowledge and discovering novel applications for organic compounds, potentially leading to breakthroughs in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 7435-83-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 7,4,3 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 7435-83:
(6*7)+(5*4)+(4*3)+(3*5)+(2*8)+(1*3)=108
108 % 10 = 8
So 7435-83-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H15Cl/c1-7-5-8(2)10(4)11(6-12)9(7)3/h5H,6H2,1-4H3
