850429-58-2 Usage
Uses
Used in Pharmaceutical Synthesis:
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE is used as an intermediate in the synthesis of various pharmaceuticals for its ability to participate in a range of chemical reactions, contributing to the development of new drugs with potential therapeutic applications.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE is utilized as a key intermediate, facilitating the creation of diverse organic compounds due to its reactivity and structural properties.
Used in Anti-Cancer Treatments:
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE is studied for its potential use in anti-cancer treatments, where it may contribute to the development of novel therapeutic agents targeting cancer cells, based on its chemical properties and interactions with biological systems.
Used as an Enzyme Inhibitor:
2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE is also considered for its role as an enzyme inhibitor, where it may be employed to modulate enzyme activity, an important aspect in the regulation of various biological processes and potential treatment of diseases.
Used in Chemical Reactions and Processes:
Due to its high solubility and reactivity, 2,5-DIBROMO-1,4-DIMETHYL-1H-IMIDAZOLE is used in a variety of chemical reactions and processes, where its substitution reactions are particularly valuable for the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 850429-58-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,5,0,4,2 and 9 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 850429-58:
(8*8)+(7*5)+(6*0)+(5*4)+(4*2)+(3*9)+(2*5)+(1*8)=172
172 % 10 = 2
So 850429-58-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H6Br2N2/c1-3-4(6)9(2)5(7)8-3/h1-2H3
