The D-Aspartic acid disodium salt, with the CAS registry number 922166-98-1, is also known as D-Aspartic acid, sodium salt (1:2). This chemical's molecular formula is C₄H₅NNa₂O₄ and molecular weight is 177.07. What's more, its systematic name is Disodium (2R)-2-aminosuccinate.

Physical properties of D-Aspartic acid disodium salt are: (1)ACD/LogP: -0.669; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -4.10; (4)ACD/LogD (pH 7.4): -4.17; (5)ACD/BCF (pH 5.5): 1.00; (6)ACD/BCF (pH 7.4): 1.00; (7)ACD/KOC (pH 5.5): 1.00; (8)ACD/KOC (pH 7.4): 1.00; (9)#H bond acceptors: 5; (10)#H bond donors: 4; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 77.84 Å²; (13)Flash Point: 113.5 °C; (14)Enthalpy of Vaporization: 55.26 kJ/mol; (15)Boiling Point: 264.1 °C at 760 mmHg; (16)Vapour Pressure: 0.003 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [Na+].[Na+].[O-]C(=O)C[C@@H](N)C([O-])=O
(2)Std. InChI: InChI=1S/C4H7NO4.2Na/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;/q;2*+1/p-2/t2-;;/m1../s1
(3)Std. InChIKey: XMXOIHIZTOVVFB-YBBRRFGFSA-L