The Imidazo[1,2-a]pyridine-2-carboxylic acid, its cas register number is 64951-08-2. It also can be called as Imidazo[1,2-a]pyridine-2-carboxylicacid and the IUPAC name about this chemical is imidazo[1,2-a]pyridine-2-carboxylic acid. It belongs to the following product categories, such as pharmacetical, Carboxylic Acids, Carboxylic Acids, Fused Ring Systems, Building Blocks, Imidazo[x,x-y]pyridine and so on.

Physical properties about Imidazo[1,2-a]pyridine-2-carboxylic acid are: (1)ACD/LogP: 1.03; (2)ACD/LogD (pH 5.5): -1.48; (3)ACD/LogD (pH 7.4): -1.71; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 43.6Ų; (12)Index of Refraction: 1.676; (13)Molar Refractivity: 43.02 cm³; (14)Molar Volume: 114.3 cm³; (15)Polarizability: 17.05 10^-24cm³; (16)Surface Tension: 60.5 dyne/cm

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC2=NC(=CN2C=C1)C(=O)O
(2)InChI: InChI=1S/C8H6N2O2/c11-8(12)6-5-10-4-2-1-3-7(10)9-6/h1-5H,(H,11,12)
(3)InChIKey: WQLJLPDGSLZYEP-UHFFFAOYSA-N