The Imidazo[1,2-a]pyridine-3-carboxaldehyde,2,7-dimethyl-, with the CAS registry number 820245-84-9, is also known as 2,7-Dimethyl-imidazo[1,2-a]pyridine-3-carbaldehyde. This chemical's molecular formula is C₁₀H₁₀N₂O and molecular weight is 174.2. What's more, both its IUPAC name and systematic name are the same which is called 2,7-Dimethylimidazo[1,2-a]pyridine-3-carbaldehyde.

Physical properties about Imidazo[1,2-a]pyridine-3-carboxaldehyde,2,7-dimethyl- are: (1)ACD/LogP: 1.69; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.49; (4)ACD/LogD (pH 7.4): 1.69; (5)ACD/BCF (pH 5.5): 7.06; (6)ACD/BCF (pH 7.4): 11.29; (7)ACD/KOC (pH 5.5): 123.2; (8)ACD/KOC (pH 7.4): 196.83; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 34.37 Å²; (13)Index of Refraction: 1.608; (14)Molar Refractivity: 51.02 cm³; (15)Molar Volume: 147.5 cm³; (16)Polarizability: 20.22×10^-24 cm³; (17)Surface Tension: 41.9 dyne/cm; (18)Density: 1.18 g/cm³.

You can still convert the following datas into molecular structure:
(1) SMILES: O=Cc1c(nc2cc(ccn12)C)C
(2) InChI: InChI=1/C10H10N2O/c1-7-3-4-12-9(6-13)8(2)11-10(12)5-7/h3-6H,1-2H3
(3) InChIKey: RODAAWLSKNVZGK-UHFFFAOYAR