The Isooctadecanoic acid, with the CAS registry number 30399-84-9, is also known as Haimaric MKH(R). Its EINECS registry number is 250-178-0. This chemical's molecular formula is C₁₈H₃₆O₂ and molecular weight is 284.48. What's more, its IUPAC name and systematic name are the same which is called 16-Methylheptadecanoic acid. It is used as cosmetic raw materials, advanced lubricant additives, raw materials of various esters.

Physical properties about Isooctadecanoic acid: (1)ACD/LogP: 8.03; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 7.24; (4)ACD/LogD (pH 7.4): 5.44; (5)ACD/BCF (pH 5.5): 119777.13; (6)ACD/BCF (pH 7.4): 1921.53 ; (7)ACD/KOC (pH 5.5): 89208.37; (8)ACD/KOC (pH 7.4): 1431.13 ; (9)#H bond acceptors: 2; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 15; (12)Polar Surface Area: 26.3 Å²; (13)Index of Refraction: 1.454; (14)Molar Refractivity: 86.96 cm³; (15)Molar Volume: 320.6 cm³; (16)Surface Tension: 32.8 dyne/cm; (17)Density: 0.887 g/cm³; (18)Flash Point: 225.6 °C; (19)Enthalpy of Vaporization: 71.52 kJ/mol; (20)Boiling Point: 400.8 °C at 760 mmHg; (21)Vapour Pressure: 1.52E-07 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: O=C(O)CCCCCCCCCCCCCCC(C)C
(2) InChI: InChI=1/C18H36O2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h17H,3-16H2,1-2H3,(H,19,20)
(3) InChIKey: XDOFQFKRPWOURC-UHFFFAOYAQ

The toxicity data is as follows: