The L-Glutamicacid, N-methyl-, with the CAS registry number 6753-62-4, is also known as DL-Glutamic acid, N-methyl-. This chemical's molecular formula is C₆H₁₁NO₄ and molecular weight is 161.15584. Its IUPAC name is called 2-(methylamino)pentanedioic acid.

Physical properties of L-Glutamicacid, N-methyl-: (1)ACD/LogP: -1.20; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 1; (5)ACD/KOC (pH 7.4): 1; (6)#H bond acceptors: 5; (7)#H bond donors: 3; (8)#Freely Rotating Bonds: 5; (9)Index of Refraction: 1.491; (10)Molar Refractivity: 36.52 cm³; (11)Molar Volume: 126 cm³; (12)Surface Tension: 52.8 dyne/cm; (13)Density: 1.278 g/cm³; (14)Flash Point: 153.5 °C; (15)Enthalpy of Vaporization: 62.96 kJ/mol; (16)Boiling Point: 330.2 °C at 760 mmHg; (17)Vapour Pressure: 3.31E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CNC(CCC(=O)O)C(=O)O
(2)InChI: InChI=1S/C6H11NO4/c1-7-4(6(10)11)2-3-5(8)9/h4,7H,2-3H2,1H3,(H,8,9)(H,10,11)
(3)InChIKey: XLBVNMSMFQMKEY-UHFFFAOYSA-N