The Octanoic acid,3-hydroxy-, with the CAS registry number 14292-27-4, is also known as 3-Hydroxyoctanoate. This chemical's molecular formula is C₈H₁₆O₃ and molecular weight is 160.21084. Its IUPAC name is called 3-hydroxyoctanoic acid.

Physical properties of Octanoic acid,3-hydroxy-: (1)ACD/LogP: 0.99; (2)ACD/LogD (pH 5.5): -0.25; (3)ACD/LogD (pH 7.4): -2.04; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 4.73; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 3; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 7; (11)Index of Refraction: 1.463; (12)Molar Refractivity: 42.16 cm³; (13)Molar Volume: 153 cm³; (14)Surface Tension: 40.5 dyne/cm; (15)Density: 1.046 g/cm³; (16)Flash Point: 142.4 °C; (17)Enthalpy of Vaporization: 61.21 kJ/mol; (18)Boiling Point: 288.3 °C at 760 mmHg; (19)Vapour Pressure: 0.000263 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: CCCCCC(CC(=O)O)O
(2)InChI: InChI=1S/C8H16O3/c1-2-3-4-5-7(9)6-8(10)11/h7,9H,2-6H2,1H3,(H,10,11)
(3)InChIKey: NDPLAKGOSZHTPH-UHFFFAOYSA-N