The Phenol,2-(chloromethyl)-, with the CAS registry number 40053-98-3, is also known as (Chloromethyl)phenol. This chemical's molecular formula is C₇H₇ClO and molecular weight is 142.58288. Its IUPAC name is called 2-(chloromethyl)phenol.

Physical properties of Phenol,2-(chloromethyl)-: (1)ACD/LogP: 1.75; (2)ACD/LogD (pH 5.5): 1.75; (3)ACD/LogD (pH 7.4): 1.75; (4)ACD/BCF (pH 5.5): 12.6; (5)ACD/BCF (pH 7.4): 12.49; (6)ACD/KOC (pH 5.5): 213.43; (7)ACD/KOC (pH 7.4): 211.62; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 2; (11)Index of Refraction: 1.569; (12)Molar Refractivity: 37.9 cm³; (13)Molar Volume: 115.5 cm³; (14)Surface Tension: 43.9 dyne/cm; (15)Density: 1.233 g/cm³; (16)Flash Point: 99.3 °C; (17)Enthalpy of Vaporization: 49.69 kJ/mol; (18)Boiling Point: 240.7 °C at 760 mmHg; (19)Vapour Pressure: 0.0242 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C(=C1)CCl)O
(2)InChI: InChI=1S/C7H7ClO/c8-5-6-3-1-2-4-7(6)9/h1-4,9H,5H2
(3)InChIKey: AUESJGZPPPVYJZ-UHFFFAOYSA-N