The Pyridazine,3-chloro-6-(methylsulfonyl)- is an organic compound with the formula C₅H₅ClN₂O₂S. The IUPAC name of this chemical is 3-chloro-6-methylsulfonylpyridazine and the CAS registry number is 7145-62-2. In addition, the molecular weight is 192.62.

The other characteristics of Pyridazine,3-chloro-6-(methylsulfonyl)- can be summarized as: (1)ACD/LogP: -1.66; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 68.3 Å²; (7)Index of Refraction: 1.539; (8)Molar Refractivity: 40.62 cm³; (9)Molar Volume: 129.6 cm³; (10)Polarizability: 16.1×10^-24 cm³; (11)Surface Tension: 54.1 dyne/cm; (12)Density: 1.486 g/cm³; (13)Flash Point: 226.8 °C; (14)Enthalpy of Vaporization: 68.31 kJ/mol; (15)Boiling Point: 451.4 °C at 760 mmHg; (16)Vapour Pressure: 6.54E-08 mmHg at 25°C; (17)Rotatable Bond Count: 1; (18)Exact Mass: 191.976026; (19)MonoIsotopic Mass: 191.976026; (20)Topological Polar Surface Area: 68.3; (21)Heavy Atom Count: 11; (22)Complexity: 223.

People can use the following data to convert to the molecule structure.
1. SMILES:Clc1nnc(cc1)S(=O)(=O)C
2. InChI:InChI=1/C5H5ClN2O2S/c1-11(9,10)5-3-2-4(6)7-8-5/h2-3H,1H3
3. InChIKey:BUHGCLPAHGFCLE-UHFFFAOYAC
4. Std. InChI:InChI=1S/C5H5ClN2O2S/c1-11(9,10)5-3-2-4(6)7-8-5/h2-3H,1H3
5. Std. InChIKey:BUHGCLPAHGFCLE-UHFFFAOYSA-N