The Pyridazine, 3-bromo-6-methyl- is an organic compound with the formula C₅H₅BrN₂. The systematic name of this chemical is 3-bromo-6-methylpyridazine and CAS registry number is 65202-58-6. In addition, the molecular weight is 173.01.

The other characteristics of Pyridazine, 3-bromo-6-methyl- can be summarized as: (1)ACD/LogP: 0.54; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 0; (6)Polar Surface Area: 25.78 Å²; (7)Index of Refraction: 1.558; (8)Molar Refractivity: 34.95 cm³; (9)Molar Volume: 108.341 cm³; (10)Polarizability: 13.855×10^-24 cm³; (11)Surface Tension: 47.025 dyne/cm; (12)Density: 1.597 g/cm³; (13)Flash Point: 126.188 °C; (14)Enthalpy of Vaporization: 50.303 kJ/mol; (15)Boiling Point: 285.041 °C at 760 mmHg; (16)Vapour Pressure: 0.005 mmHg at 25°C.

People can use the following data to convert to the molecule structure. 
1. SMILES:Brc1nnc(cc1)C
2. InChI:InChI=1/C5H5BrN2/c1-4-2-3-5(6)8-7-4/h2-3H,1H3
3. InChIKey:RACIHBXDZONTQJ-UHFFFAOYAW
4. Std. InChI:InChI=1S/C5H5BrN2/c1-4-2-3-5(6)8-7-4/h2-3H,1H3
5. Std. InChIKey:RACIHBXDZONTQJ-UHFFFAOYSA-N