If the 2,2'-bipyridine ligand has substituents that are more sterically demanding or if the reaction conditions favor C-H activation over C-Me bond activation, then palladium may insert into aromatic C-H bonds instead. The activation of C-H bonds in aromatic systems often requires harsher reaction conditions and is generally less selective, as it can occur at various positions on the aromatic ring.
If you need to purchase chemical raw materials, submit your demand information to get the latest quotations.
PdN2C10H6C4H9P(C6H5)3(1+)*BF4(1-)=PdN2C10H6C4H9P(C6H5)3BF4
N,N-bis(2-cyano-5-methoxyphenyl)-3-(3-methoxyphenyl)propanamide
Benzenesulfonamide, 2,4,6-trimethyl-N-[(1S)-1-(1-methylethyl)-2,3-butadienyl]-N-[(2E)-3-phen yl-2-propenyl]-
