1. Introduction of Trapidil
Trapidil, with the IUPAC Name of N,N-Diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine, is one kind of white or almost white crystalline powder. Trapidil has been used for anti-angina drug.
2. Properties of Trapidil
(1)Density: 1.2 g/cm3; (2)Index of Refraction: 1.625; (3)XLogP3-AA: 1.7; (4)H-Bond Donor: 0; (5)H-Bond Acceptor: 4.
3. Structure Descriptors of Trapidil
You could convert the following datas into the molecular structure:
(1).Canonical SMILES: CCN(CC)C1=CC(=NC2=NC=NN12)C
(2).InChI: InChI=1S/C10H15N5/c1-4-14(5-2)9-6-8(3)13-10-11-7-12-15(9)10/h6-7H,4-5H2,1-3H3
(3).InChIKey: GSNOZLZNQMLSKJ-UHFFFAOYSA-N
4. Toxicity of Trapidil
Organism | Test Type | Route | Reported Dose (Normalized Dose) | Effect | Source |
mouse | LD50 | intraperitoneal | 155mg/kg (155mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
mouse | LD50 | intravenous | 101mg/kg (101mg/kg) | | Iyakuhin Kenkyu. Study of Medical Supplies. Vol. 10, Pg. 232, 1979. |
mouse | LD50 | oral | 380mg/kg (380mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
mouse | LD50 | subcutaneous | 132mg/kg (132mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
rat | LD50 | intraperitoneal | 100mg/kg (100mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
rat | LD50 | intravenous | 76mg/kg (76mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
rat | LD50 | oral | 235mg/kg (235mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |
rat | LD50 | subcutaneous | 100mg/kg (100mg/kg) | | Pharmazie. Vol. 26, Pg. 554, 1971. |