1. Introduction of Trapidil

Trapidil, with the IUPAC Name of N,N-Diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine, is one kind of white or almost white crystalline powder. Trapidil has been used for anti-angina drug.

2. Properties of Trapidil

(1)Density: 1.2 g/cm³; (2)Index of Refraction: 1.625; (3)XLogP3-AA: 1.7; (4)H-Bond Donor: 0; (5)H-Bond Acceptor: 4.

3. Structure Descriptors of Trapidil

You could convert the following datas into the molecular structure:
(1).Canonical SMILES: CCN(CC)C1=CC(=NC2=NC=NN12)C
(2).InChI: InChI=1S/C10H15N5/c1-4-14(5-2)9-6-8(3)13-10-11-7-12-15(9)10/h6-7H,4-5H2,1-3H3 
(3).InChIKey: GSNOZLZNQMLSKJ-UHFFFAOYSA-N

4. Toxicity of Trapidil