Products Categories
CAS No.: | 10196-04-0 |
---|---|
Name: | Ammonium sulfite |
Molecular Structure: | |
Formula: | H3N.1/2H2O3S |
Molecular Weight: | 116.14 |
Synonyms: | Sulfurousacid, diammonium salt (8CI,9CI);Sulfurous acid, diammonium salt;Diammonium sulfite;Diammonium sulfonate;HSDB 1426;Sulfurous acid, diammonium salt;UNII-8LF589Y5GD; |
EINECS: | 233-484-9 |
Density: | 1.41 g/cm3 (25 °C) |
Melting Point: | 60-70 °C |
Boiling Point: | 150oC |
Solubility: | Soluble in water, slightly soluble in alcohol |
Appearance: | Colorless monoclinic crystal |
Hazard Symbols: | Xn |
Risk Codes: | R20/22 |
PSA: | 83.22000 |
LogP: | 1.19460 |
The Ammonium sulfite with CAS registry number of 10196-04-0 is also known as Sulfurous acid,ammonium salt (1:2). The IUPAC name is Diazanium sulfite. It belongs to product categories of Industrial/Fine Chemicals; Inorganics. Its EINECS registry number is 233-484-9. In addition, the formula is H3N.1/2H2O3S and the molecular weight is 116.14. This chemical is a colorless monoclinic crystal that soluble in water and slightly soluble in alcohol. It is a reducing agent and efficient absorber. It also can be used for medical, photographic reducing agent, dyes intermediate and so on.
Physical properties about Ammonium sulfite are: (1)ACD/LogP: -1.59; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): -6.06; (4)ACD/LogD (pH 7.4): -6.09; (5)ACD/BCF (pH 5.5): 1; (6)ACD/BCF (pH 7.4): 1; (7)#H bond acceptors: 3; (8)#H bond donors: 2; (9)Polar Surface Area: 76.74Å2.
Preparation of Ammonium sulfite: it can be prepared by the reaction of ammonia with sulfur dioxide in aqueous solution.
NH3 + SO2 + H2O → (NH4)2SO3
You can still convert the following datas into molecular structure:
1. Canonical SMILES: [NH4+].[NH4+].[O-]S(=O)[O-]
2. InChI: InChI=1S/2H3N.H2O3S/c;;1-4(2)3/h2*1H3;(H2,1,2,3)
3. InChIKey: PQUCIEFHOVEZAU-UHFFFAOYSA-N