Products Categories
CAS No.: | 107-73-3 |
---|---|
Name: | phosphorylcholine |
Article Data: | 9 |
Molecular Structure: | |
|
|
Formula: | C5H15NO4P.Cl |
Molecular Weight: | 219.605 |
Synonyms: | Choline phosphate;Choline phosphate chloride;Phosphocholine;Phosphorylcholine chloride;Ethanaminium, N,N,N-trimethyl-2-(phosphonooxy)-, chloride;Trimethyl(2-(phosphonooxy)ethyl)ammonium chloride;N,N,N-trimethyl-2-(phosphonooxy)ethanaminium chloride;AC1Q1SNA;PC-Cl; |
EINECS: | 203-516-6 |
Melting Point: | 108-111 °C (decomp) |
Boiling Point: | 103 °C(Press: 12 Torr) |
PSA: | 76.57000 |
LogP: | -3.19410 |
The Ethanaminium,N,N,N-trimethyl-2-(phosphonooxy)-, chloride (1:1) with CAS registry number of 107-73-3 is also known as Phosphorylcholine. The IUPAC name is Trimethyl(2-(phosphonooxy)ethyl)ammonium chloride. Its EINECS registry number is 203-516-6. In addition, the formula is C5H15NO4P.Cl and the molecular weight is 219.60.
Physical properties about Ethanaminium,N,N,N-trimethyl-2-(phosphonooxy)-, chloride (1:1) are: (1)ACD/LogP: -4.99; (2)ACD/LogD (pH 5.5): -4.49; (3)ACD/LogD (pH 7.4): -5.25; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 5; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 54.57Å2.
You can still convert the following datas into molecular structure:
1. Canonical SMILES: C[N+](C)(C)CCOP(=O)(O)O.[Cl-]
2. InChI: InChI=1S/C5H14NO4P.ClH/c1-6(2,3)4-5-10-11(7,8)9;/h4-5H2,1-3H3,(H-,7,8,9);1H
3. InChIKey: PYJNAPOPMIJKJZ-UHFFFAOYSA-N