Products Categories
| CAS No.: | 1137-69-5 |
|---|---|
| Name: | 2-chlorophenazine |
| Molecular Structure: | |
|
|
|
| Formula: | C12H7ClN2 |
| Molecular Weight: | 214.654 |
| Synonyms: | 2-Chlorophenazine;NSC 402849; |
| Density: | 1.375 g/cm3 |
| Melting Point: | 140℃ |
| Boiling Point: | 389.8 °C at 760 mmHg |
| Flash Point: | 221.7 °C |
| PSA: | 25.78000 |
| LogP: | 3.43640 |
The CAS registry number of Phenazine,2-chloro- is 1137-69-5. The IUPAC name is 2-chlorophenazine. In addition, the molecular formula is C12H7ClN2 and the molecular weight is 214.6504. It should be stored in a cool and dry place.
Physical properties about Phenazine,2-chloro- are: (1)ACD/LogP: 3.44; (2)#H bond acceptors: 2; (3)#Freely Rotating Bonds: 0; (4)Polar Surface Area: 25.78 Å2; (5)Index of Refraction: 1.741; (6)Molar Refractivity: 63.01 cm3; (7)Molar Volume: 156 cm3; (8)Polarizability: 24.98 ×10-24cm3; (9)Surface Tension: 62.6 dyne/cm; (10)Density: 1.375 g/cm3; (11)Flash Point: 221.7 °C; (12)Enthalpy of Vaporization: 61.42 kJ/mol; (13)Boiling Point: 389.8 °C at 760 mmHg; (14)Vapour Pressure: 6.23E-06 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)SMILES: Clc2ccc1nc3c(nc1c2)cccc3
(2)InChI: InChI=1/C12H7ClN2/c13-8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H
(3)InChIKey: LYZDGXICDJEHAD-UHFFFAOYAF