Products Categories
| CAS No.: | 33675-75-1 |
|---|---|
| Name: | 3-PHENETHYL-PHENOL |
| Molecular Structure: | |
|
|
|
| Formula: | C14H14O |
| Molecular Weight: | 198.26 |
| Synonyms: | Phenol,m-phenethyl- (8CI);1-m-Hydroxyphenyl-2-phenylethane;3-Phenethylphenol;3-(2-Phenylethyl)phenol;1-(3-Hydroxyphenyl)-2-phenylethane; |
| Density: | 1.093 g/cm3 |
| Boiling Point: | 319.7 °C at 760 mmHg |
| Flash Point: | 151.6 °C |
| PSA: | 20.23000 |
| LogP: | 3.17740 |
The Phenol,3-(2-phenylethyl)-, with the CAS registry number 33675-75-1, is also known as 1-(3-Hydroxyphenyl)-2-phenylethane. This chemical's molecular formula is C14H14O and molecular weight is 198.26. What's more, its IUPAC name is 3-phenethylphenol.
Physical properties of Phenol,3-(2-phenylethyl)- are: (1)ACD/LogP: 3.96; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.96; (4)ACD/BCF (pH 5.5): 604.84; (5)ACD/BCF (pH 7.4): 603.31; (6)ACD/KOC (pH 5.5): 3409.53; (7)ACD/KOC (pH 7.4): 3400.95; (8)#H bond acceptors: 1; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 4; (11)Polar Surface Area: 9.23 Å2; (12)Index of Refraction: 1.601; (13)Molar Refractivity: 62.17 cm3; (14)Molar Volume: 181.3 cm3; (15)Surface Tension: 45.4 dyne/cm; (16)Density: 1.093 g/cm3; (17)Flash Point: 151.6 °C; (18)Enthalpy of Vaporization: 58.36 kJ/mol; (19)Boiling Point: 319.7 °C at 760 mmHg; (20)Vapour Pressure: 0.000178 mmHg at 25°C.
You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC=C(C=C1)CCC2=CC(=CC=C2)O
(2)InChI: InChI=1S/C14H14O/c15-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-8,11,15H,9-10H2
(3)InChIKey: AIHZDRMFOVBNAV-UHFFFAOYSA-N