Products Categories
CAS No.: | 5743-48-6 |
---|---|
Name: | calcium lactate |
Molecular Structure: | |
|
|
Formula: | C3H6O3.xCa |
Molecular Weight: | 0 |
Synonyms: | Lacticacid, calcium salt (8CI);Propanoic acid, 2-hydroxy-, calcium salt (9CI); |
EINECS: | 227-266-2 |
PSA: | 120.72000 |
LogP: | -3.76580 |
The CAS registry number of Propanoic acid,2-hydroxy-, calcium salt (1:?) is 5743-48-6. This chemical is also named as 2-Hydroxypropanoic acid/calcium,(1:x) salt. Its EINECS registry number is 227-266-2. In addition, its molecular formula is C3H6O3.xCa. The systematic name of Propanoic acid,2-hydroxy-, calcium salt (1:?) is called Calcium lactate.
You can still convert the following datas into molecular structure:
(1)InChI: InChI=1/2C3H6O3.Ca/c2*1-2(4)3(5)6;/h2*2,4H,1H3,(H,5,6);/q;;+2/p-2
(2)Smiles: [Ca+2].C(=O)([O-])[C@@H](O)C.C([C@@H](O)C)(=O)[O-]