Products Categories
| CAS No.: | 6367-42-6 |
|---|---|
| Name: | H-D-ASP-OBZL |
| Molecular Structure: | |
|
|
|
| Formula: | C11H13NO4 |
| Molecular Weight: | 223.23 |
| Synonyms: | Asparticacid, N-benzyl-, D- (8CI);H-D-Asp-Obzl; |
| Density: | 1.311 g/cm3 |
| Melting Point: | 209℃ |
| Boiling Point: | 376.738 °C at 760 mmHg |
| Flash Point: | 181.645 °C |
| PSA: | 89.62000 |
| LogP: | 1.23210 |
The H-D-Asp-Obzl is an organic compound with the formula C11H13NO4. The systematic name of this chemical is N-benzyl-D-aspartic acid. With the CAS registry number 6367-42-6, it is also named as D-Benzylaminosuccinic acid. The product's categories are Amino Acids Derivatives; A - H; Amino Acids; Modified Amino Acids. It is used as peptide synthesis. Additionally, this chemical should be stored at the temperature of -20°C.
The other characteristics of H-D-Asp-Obzl can be summarized as: (1)ACD/LogP: 1.76; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 3; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 55.84 Å2; (7)Index of Refraction: 1.576; (8)Molar Refractivity: 56.38 cm3; (9)Molar Volume: 170.2 cm3; (10)Polarizability: 22.35×10-24 cm3; (11)Surface Tension: 59.2 dyne/cm; (12)Density: 1.311 g/cm3; (13)Flash Point: 181.6 °C; (14)Enthalpy of Vaporization: 65.87 kJ/mol; (15)Boiling Point: 376.7 °C at 760 mmHg; (16)Vapour Pressure: 2.4E-06 mmHg at 25°C.
People can use the following data to convert to the molecule structure.
1. SMILES:O=C(O)C[C@@H](NCc1ccccc1)C(=O)O
2. InChI:InChI=1/C11H13NO4/c13-10(14)6-9(11(15)16)12-7-8-4-2-1-3-5-8/h1-5,9,12H,6-7H2,(H,13,14)(H,15,16)/t9-/m1/s1
3. InChIKey:RKSKSWSMXZYPFW-SECBINFHBP