10222-49-8 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-2-methylquinoline is used as a pharmaceutical intermediate for the synthesis of various drugs and medicinal compounds. Its unique chemical structure and properties allow it to be incorporated into the development of new therapeutic agents with potential applications in treating various diseases and medical conditions.
Used in Agrochemical Industry:
3-Chloro-2-methylquinoline is used as an agrochemical intermediate for the synthesis of pesticides, herbicides, and other crop protection agents. Its biological activity can contribute to the development of effective and targeted solutions for managing pests and diseases in agriculture, thereby enhancing crop yield and quality.
However, it is important to consider the potential health hazards and environmental risks associated with 3-chloro-2-methylquinoline. Proper handling, storage, and disposal measures should be implemented to minimize any adverse effects on human health and the environment. The usage of this chemical compound should be carefully regulated and monitored to ensure its safe and responsible application in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10222-49-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,2,2 and 2 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10222-49:
(7*1)+(6*0)+(5*2)+(4*2)+(3*2)+(2*4)+(1*9)=48
48 % 10 = 8
So 10222-49-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H8ClN/c1-7-9(11)6-8-4-2-3-5-10(8)12-7/h2-6H,1H3
