1095-15-4 Usage
Properties
1. Chemical compound
2. Derivatizing agent for carbonyl compounds
3. Forms stable derivatives
4. Useful in identifying and quantifying carbonyl compounds
5. Used in analytical chemistry, environmental monitoring, food analysis, and pharmaceutical research
6. Molecular formula: C24H24N4O2
7. Molecular weight: 400.47 g/mol
8. Melting point: 186-188°C
9. Should be handled and stored in a dry, cool environment
Specific content
1. Chemical name: 2,5-Hexanedione, bis(phenylhydrazone)
2. Function: Derivatizing agent for carbonyl compounds
3. Application: Analytical chemistry, environmental monitoring, food analysis, pharmaceutical research
4. Molecular formula: C24H24N4O2
5. Molecular weight: 400.47 g/mol
6. Melting point: 186-188°C
7. Storage: Dry, cool environment
Check Digit Verification of cas no
The CAS Registry Mumber 1095-15-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,0,9 and 5 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1095-15:
(6*1)+(5*0)+(4*9)+(3*5)+(2*1)+(1*5)=64
64 % 10 = 4
So 1095-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C18H22N4/c1-15(19-21-17-9-5-3-6-10-17)13-14-16(2)20-22-18-11-7-4-8-12-18/h3-12,21-22H,13-14H2,1-2H3/b19-15+,20-16+