1123-54-2 Usage
Uses
Used in Pharmaceutical Industry:
1H-1,2,3-Triazolo[4,5-d]pyrimidin-7-amine is used as a reagent for the development of acyclic nucleotide analogs derived from 8-Azapurines. These analogs have potential applications in the synthesis of novel therapeutic agents, particularly in the treatment of various diseases and conditions.
Used in Chemical Research:
As a unique chemical structure, 1H-1,2,3-Triazolo[4,5-d]pyrimidin-7-amine can be utilized in chemical research to explore its properties, reactivity, and potential use in the synthesis of other related compounds. This can contribute to the advancement of knowledge in the field of heterocyclic chemistry and the discovery of new applications for 1H-1,2,3-Triazolo[4,5-d]pyrimidin-7-amine.
Purification Methods
8-Azaadenine crystallises from H2O. [Beilstein 25 III/IV 4157.]
Check Digit Verification of cas no
The CAS Registry Mumber 1123-54-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,2 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1123-54:
(6*1)+(5*1)+(4*2)+(3*3)+(2*5)+(1*4)=42
42 % 10 = 2
So 1123-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N6/c5-3-2-4(7-1-6-3)9-10-8-2/h1-2H,(H2,5,6,7,8,9)
