115122-63-9 Usage
Description
TIMTEC-BB SBB010636, also known as 2,2,2-Trichloro-N-(4-methylsulfonylphenyl)acetamide, is a white crystalline solid with a molecular formula of C9H8Cl3NO3S and a molecular weight of 293.59 g/mol. It is a chemical compound that has demonstrated herbicidal activity and is used as a pesticide intermediate in various industrial and agricultural applications.
Uses
Used in Pesticide Industry:
TIMTEC-BB SBB010636 is used as a pesticide intermediate for its herbicidal activity against different types of weeds. It helps control and manage weed growth in agricultural fields, ensuring better crop yield and quality.
Used in Agricultural Applications:
In agriculture, TIMTEC-BB SBB010636 is used as a herbicide to protect crops from weed competition. Its application helps maintain soil health and promotes the growth of desired plant species, leading to increased productivity and better crop management.
Used in Industrial Applications:
TIMTEC-BB SBB010636 is also utilized in various industrial applications, where its chemical properties contribute to the development and production of different products. Its versatility as a chemical intermediate allows for its use in multiple industries, enhancing the manufacturing process and final product quality.
Environmental and Safety Profile:
TIMTEC-BB SBB010636 has been studied for its potential environmental impact and safety profile. Understanding its effects on the environment and ensuring its safe use in various applications is crucial for maintaining ecological balance and ensuring the well-being of humans and other living organisms.
Check Digit Verification of cas no
The CAS Registry Mumber 115122-63-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,5,1,2 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 115122-63:
(8*1)+(7*1)+(6*5)+(5*1)+(4*2)+(3*2)+(2*6)+(1*3)=79
79 % 10 = 9
So 115122-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H9NO3/c11-8-6(9(12)13)4-5-2-1-3-7(5)10-8/h4H,1-3H2,(H,10,11)(H,12,13)
