1199-85-5 Usage
Uses
Used in Chemical Synthesis:
p-Aminomethamphetamine is used as a chemical intermediate for the synthesis of various compounds. It serves as a building block in the production of different organic molecules, contributing to the formation of complex structures with specific properties.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, p-Aminomethamphetamine is used as a precursor in the synthesis of certain medications. Its unique chemical structure allows it to be a key component in the development of drugs with specific therapeutic effects.
Used in Catalyst Preparation:
p-Aminomethamphetamine is used as a catalyst or a component in the preparation of catalysts for various chemical reactions. Its presence can enhance the efficiency and selectivity of these reactions, leading to improved yields and reduced reaction times.
For example, it was used to prepare Ind2TiMe2-catalyzed addition of methyland ethylamine to alkynes, which is a specific application in the field of chemical synthesis. This demonstrates the versatility of p-Aminomethamphetamine in facilitating different types of chemical reactions and its importance in the synthesis of various compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 1199-85-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,1,9 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1199-85:
(6*1)+(5*1)+(4*9)+(3*9)+(2*8)+(1*5)=95
95 % 10 = 5
So 1199-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H14ClN/c1-8(12-2)7-9-5-3-4-6-10(9)11/h3-6,8,12H,7H2,1-2H3
1199-85-5Relevant academic research and scientific papers
Ind2TiMe2-catalyzed addition of methyl- and ethylamine to alkynes
Marcsekova, Klaudia,Wegener, Bernd,Doye, Sven
, p. 4843 - 4851 (2007/10/03)
We describe a very simple hydrogenation-like experimental protocol for the addition of gaseous methyl- and ethylamine to alkynes in the presence of Ind2TiMe2 as the catalyst. For efficient hydroamination reactions it is sufficient to stir a mixture of the alkyne and the catalyst in toluene at temperatures between 80°C (terminal alkynes) and 105°C (internal alkynes) under a constant pressure of 1 atm of the corresponding amine. After subsequent reduction of the initially formed imines, methyl- and ethylamine derivatives are the final products of the described one-pot reaction sequences. In the case of 2-alkyl-1-phenylalkynes as starting materials, biologically interesting 2-phenylethylamine derivatives possessing a small methyl or ethyl substituent at the N atom are easily accessible by the new reaction protocol. Wiley-VCH Verlag GmbH & Co. KGaA, 2005.
