126739-64-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Methoxy-2-nitropyridine is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its role in the formation of heterocyclic compounds makes it a valuable component in the creation of complex molecular structures with potential medicinal properties.
Used in Agrochemical Industry:
In the agrochemical industry, 5-methoxy-2-nitropyridine is utilized as an intermediate in the production of agrochemicals, such as pesticides and herbicides. Its involvement in the synthesis of these compounds helps to enhance crop protection and contribute to increased agricultural productivity.
Used in Organic Synthesis:
5-Methoxy-2-nitropyridine is used as a building block in organic synthesis, particularly for the formation of heterocyclic compounds. Its unique structure allows for the creation of a variety of complex organic molecules, which can be further utilized in various chemical and pharmaceutical applications.
Used in Antimicrobial Applications:
5-Methoxy-2-nitropyridine has been studied for its potential antimicrobial properties, making it a candidate for use in the development of new antimicrobial agents. Its ability to inhibit the growth of certain microorganisms could contribute to the fight against antibiotic-resistant bacteria and other pathogens.
Used in Anti-inflammatory Applications:
The anti-inflammatory properties of 5-methoxy-2-nitropyridine have also been investigated, suggesting its potential use in the development of anti-inflammatory drugs. This could provide new treatment options for various inflammatory conditions and contribute to improved patient care.
Check Digit Verification of cas no
The CAS Registry Mumber 126739-64-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,6,7,3 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 126739-64:
(8*1)+(7*2)+(6*6)+(5*7)+(4*3)+(3*9)+(2*6)+(1*4)=148
148 % 10 = 8
So 126739-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O3/c1-11-5-2-3-6(7-4-5)8(9)10/h2-4H,1H3
126739-64-8Relevant articles and documents
Preparation method 5- hydroxyl -7- azaindole (by machine translation)
-
Paragraph 0031-0034, (2020/04/06)
The invention discloses 5 -hydroxy- 7 7-azaindole preparation method, which takes 5 - X - 2 -nitropyridine as a raw material to react with benzyl alcohol sodium or sodium alkyl sodium alkoxide to generate 5 - R - 2 -nitropyridine, which is benzyl, methyl or ethyl X after being closed by a Grignard reagent ring after cyclization is carried, out, and ;R is high, yield. (by machine translation)
