13035-46-6 Usage
Description
Benzyl β-D-ribopyranoside tribenzoate is a complex chemical compound derived from the benzyl ester of β-D-ribopyranoside, further modified with tribenzoate. It features a ribopyranoside core with three benzoyl groups attached, providing a versatile intermediate for various synthetic processes. Benzyl β-D-ribopyranoside tribenzoate is widely recognized for its role as a protecting group in organic synthesis, enabling precise control over chemical reactions and preventing unwanted reactions at specific functional groups.
Uses
Used in Organic Synthesis:
Benzyl β-D-ribopyranoside tribenzoate is used as a protecting group for [application reason] to prevent unwanted reactions at specific functional groups during chemical reactions. Its complex structure with three benzoyl groups attached to the ribopyranoside core makes it a versatile intermediate for various synthetic processes.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Benzyl β-D-ribopyranoside tribenzoate is used as a key intermediate for [application reason] the synthesis of complex organic molecules, particularly in the development of new drugs and therapeutic agents. Its role as a protecting group allows for precise control over chemical reactions, ensuring the desired product is obtained with minimal side reactions.
Used in Chemical Research:
Benzyl β-D-ribopyranoside tribenzoate is utilized as a research tool in chemical research for [application reason] studying the reactivity and selectivity of various functional groups in organic molecules. Its unique structure and properties make it an invaluable compound for exploring new reaction pathways and developing innovative synthetic methods.
Check Digit Verification of cas no
The CAS Registry Mumber 13035-46-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,3 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 13035-46:
(7*1)+(6*3)+(5*0)+(4*3)+(3*5)+(2*4)+(1*6)=66
66 % 10 = 6
So 13035-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C33H28O8/c34-30(24-15-7-2-8-16-24)39-27-22-38-33(37-21-23-13-5-1-6-14-23)29(41-32(36)26-19-11-4-12-20-26)28(27)40-31(35)25-17-9-3-10-18-25/h1-20,27-29,33H,21-22H2