13278-55-2 Usage
Uses
Used in Scientific Research:
1-(2,4-Dimethylphenyl)-3-methylthiourea is used as a reagent for the determination of certain metal ions in solutions. Its ability to form complexes with metal ions makes it a valuable tool in analytical chemistry for detecting and quantifying the presence of specific metals.
1-(2,4-Dimethylphenyl)-3-methylthiourea is also used as an inhibitor in the oxidation of various organic compounds. Its presence can help prevent or slow down the oxidation process, which is crucial in stabilizing certain chemical reactions and preserving the integrity of sensitive organic compounds.
Used in Pharmaceutical Development:
1-(2,4-Dimethylphenyl)-3-methylthiourea has been studied for its potential anti-cancer properties. Its ability to target and inhibit the growth of cancer cells has made it a promising candidate for the development of new cancer therapies.
Furthermore, 1-(2,4-Dimethylphenyl)-3-methylthiourea has been investigated as a potential therapeutic agent for neurodegenerative diseases. Its potential to protect and repair neurons, as well as modulate the immune response, has generated interest in its use for treating conditions such as Alzheimer's disease and Parkinson's disease.
Used in Antimicrobial Applications:
1-(2,4-Dimethylphenyl)-3-methylthiourea has been found to possess antimicrobial properties, making it a candidate for use in the development of new antimicrobial agents. Its ability to inhibit the growth of bacteria, fungi, and other microorganisms could contribute to the development of novel treatments for infectious diseases.
Used in Pesticide Formulation:
1-(2,4-Dimethylphenyl)-3-methylthiourea has also been investigated for its potential use as a pesticide. Its ability to control the growth and reproduction of pests, as well as its potential to disrupt their physiological processes, has made it a candidate for the development of new pesticides for agricultural use.
Check Digit Verification of cas no
The CAS Registry Mumber 13278-55-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,7 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13278-55:
(7*1)+(6*3)+(5*2)+(4*7)+(3*8)+(2*5)+(1*5)=102
102 % 10 = 2
So 13278-55-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2S/c1-7-4-5-9(8(2)6-7)12-10(13)11-3/h4-6H,1-3H3,(H2,11,12,13)
