13306-99-5 Usage
General Description
2-PHENYL-2H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID is a chemical compound with the molecular formula C9H7N3O2. It is a derivative of 1,2,3-triazole, which is a five-membered heterocyclic compound that contains three nitrogen atoms. 2-PHENYL-2H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID is a carboxylic acid, meaning it contains a functional group consisting of a carbon atom with a double bond to an oxygen atom and a single bond to a hydroxyl group. 2-PHENYL-2H-1,2,3-TRIAZOLE-4-CARBOXYLIC ACID is commonly used in organic synthesis and medicinal chemistry to create new compounds with potential biological activities. Its structure and properties make it a valuable building block for the development of pharmaceuticals and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 13306-99-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,0 and 6 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13306-99:
(7*1)+(6*3)+(5*3)+(4*0)+(3*6)+(2*9)+(1*9)=85
85 % 10 = 5
So 13306-99-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H7N3O2/c13-9(14)8-6-10-12(11-8)7-4-2-1-3-5-7/h1-6H,(H,13,14)/p-1
