13911-20-1 Usage
Description
(3,4-dichlorophenyl)methoxyacetic acid, also known as diclofop-methyl, is a selective herbicide derived from (3,4-dichlorophenyl)methoxyacetic acid. It is characterized by its ability to control annual and perennial grass weeds in various crops without harming broadleaf plants. This herbicide functions by inhibiting the enzyme acetyl-CoA carboxylase, which is crucial for fatty acid synthesis in plants, thereby disrupting the plant's lipid production and leading to growth inhibition and death.
Uses
Used in Agricultural Applications:
(3,4-dichlorophenyl)methoxyacetic acid is used as a herbicide for controlling grass weeds in various crops such as soybeans, rice, and wheat. Its selective nature allows it to target grassy weeds specifically, leaving broadleaf plants unharmed and maintaining crop health and yield.
Used in Weed Management:
(3,4-dichlorophenyl)methoxyacetic acid is employed in weed management strategies to ensure the growth and productivity of crops. By inhibiting essential fatty acid synthesis in grass weeds, it helps prevent competition for resources and allows the crops to thrive.
Check Digit Verification of cas no
The CAS Registry Mumber 13911-20-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,9,1 and 1 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 13911-20:
(7*1)+(6*3)+(5*9)+(4*1)+(3*1)+(2*2)+(1*0)=81
81 % 10 = 1
So 13911-20-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H8Cl2O3/c10-7-2-1-6(3-8(7)11)4-14-5-9(12)13/h1-3H,4-5H2,(H,12,13)
