15573-31-6 Usage
Uses
N-PROPYLDICHLOROPHOSPHINE is used as a reagent in Organic Synthesis for the introduction of the phosphorus trichloride functional group into organic molecules. Its high reactivity allows for the formation of various phosphorus-containing compounds, which are valuable in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
N-PROPYLDICHLOROPHOSPHINE is used as a key intermediate in the synthesis of certain pharmaceutical compounds. Its ability to introduce the phosphorus trichloride functional group enables the creation of novel drug candidates with unique properties and therapeutic potential.
Used in Agrochemical Industry:
In the agrochemical sector, N-PROPYLDICHLOROPHOSPHINE is utilized as a precursor for the development of new pesticides and insecticides. The phosphorus trichloride functional group it introduces can enhance the effectiveness and selectivity of these agrochemicals, leading to improved crop protection.
Used in Specialty Chemicals Industry:
N-PROPYLDICHLOROPHOSPHINE is employed as a building block in the production of specialty chemicals, such as flame retardants, plasticizers, and surfactants. Its reactivity allows for the creation of unique chemical structures that impart specific properties to these materials, broadening their applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 15573-31-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,7 and 3 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15573-31:
(7*1)+(6*5)+(5*5)+(4*7)+(3*3)+(2*3)+(1*1)=106
106 % 10 = 6
So 15573-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C3H7Cl2P/c1-2-3-6(4)5/h2-3H2,1H3
15573-31-6Relevant academic research and scientific papers
Synthesis, X-ray structures and chemistry of enantiomerically pure 10,11-dihydro-5-phenyl-5H-dibenzo[b,f]phosphepine 5-oxides
Wyatt, Paul,Warren, Stuart,McPartlin, Mary,Woodroffe, Tom
, p. 279 - 297 (2007/10/03)
Several phosphepine oxides were synthesised in optically pure form. Sharpless asymmetric dihydroxylation was used to introduce the chiral centres in all cases. Ring closure was achieved using either PhPCl2 or PrPCl2 together with a double nucleophile generated by either a double ortho-lithiation or double bromine-lithium exchange. The X-ray crystal structures of three phosphepine oxides illustrate their different conformations. The NMR spectra of several phosphepine oxides are described as is the chemistry which is shown to differ from that of acyclic phosphine oxides.