16025-99-3 Usage
Explanation
Different sources of media describe the Explanation of 16025-99-3 differently. You can refer to the following data:
1. The compound is composed of 24 carbon atoms, 24 hydrogen atoms, 1 iodine atom, 2 nitrogen atoms, and 1 sulfur atom.
2. The presence of charged groups and differences in electronegativity between the atoms result in a strong dipole moment, making the compound highly polar.
3. The compound can dissolve in water due to its polar nature and the presence of functional groups that can form hydrogen bonds with water molecules.
4. The compound exhibits a yellow-green color, which is a result of its electronic structure and the way it interacts with light.
5. The compound's ability to selectively stain certain types of cells and tissues makes it useful for visualizing specific cellular structures under fluorescence microscopy.
6. The compound can selectively bind to and stain certain types of cells and tissues, allowing researchers to study specific cellular structures and functions.
7. The compound has been studied for its potential use in photodynamic therapy, which involves using light-sensitive compounds to kill cancer cells and other harmful microorganisms.
8. Due to its toxic nature, the compound should be handled with care to avoid harm to humans and the environment.
Polarity
Highly polar
Water solubility
Water-soluble
Color
Yellow-green
Application
Fluorescent dye in biological and medical research
Selective staining
Specific cell and tissue targeting
Potential use
Photodynamic therapy
Safety concerns
Toxic and potentially hazardous
Check Digit Verification of cas no
The CAS Registry Mumber 16025-99-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,2 and 5 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 16025-99:
(7*1)+(6*6)+(5*0)+(4*2)+(3*5)+(2*9)+(1*9)=93
93 % 10 = 3
So 16025-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H21N2S.HI/c1-3-22-17(14-13-16-9-5-6-10-18(16)22)15-21-23(4-2)19-11-7-8-12-20(19)24-21;/h5-15H,3-4H2,1-2H3;1H/q+1;/p-1