16378-06-6 Usage
Uses
Used in Pharmaceutical Research:
3-Thien-3-ylpropanoic acid is used as a building block in the synthesis of various bioactive compounds, contributing to the development of new drugs and pharmaceuticals. Its unique molecular structure and properties make it a valuable component in the creation of innovative therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Thien-3-ylpropanoic acid serves as a key intermediate for the production of a wide range of chemical compounds. Its reactivity and functional groups allow for the formation of diverse molecular structures, expanding the scope of synthetic chemistry.
Used in Medicinal Chemistry:
3-Thien-3-ylpropanoic acid is utilized in medicinal chemistry for its potential biological activity and pharmacological properties. Researchers explore its interactions with biological targets and evaluate its efficacy in treating various diseases, making it a promising candidate for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 16378-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,3,7 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16378-06:
(7*1)+(6*6)+(5*3)+(4*7)+(3*8)+(2*0)+(1*6)=116
116 % 10 = 6
So 16378-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c8-7(9)2-1-6-3-4-10-5-6/h3-5H,1-2H2,(H,8,9)/p-1
