16698-52-5 Usage
Uses
Used in Food Industry:
Sodium 3,4-dihydro-2H-pyran-2-carboxylate is used as a flavoring agent to impart a sweet, caramel-like flavor to various food products. Its ability to enhance the taste and aroma of food items makes it a valuable addition to the culinary world.
Used in Pharmaceutical Production:
Sodium 3,4-dihydro-2H-pyran-2-carboxylate is utilized in the production of pharmaceuticals, where it serves as an essential component in the synthesis of various drugs. Its unique chemical properties contribute to the development of effective medications.
Used in Organic Synthesis:
As a precursor in organic synthesis, sodium 3,4-dihydro-2H-pyran-2-carboxylate plays a crucial role in the creation of new organic compounds. Its versatility in chemical reactions allows for the synthesis of a wide range of organic molecules, contributing to advancements in various fields, including materials science and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 16698-52-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,6,9 and 8 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 16698-52:
(7*1)+(6*6)+(5*6)+(4*9)+(3*8)+(2*5)+(1*2)=145
145 % 10 = 5
So 16698-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O3.Na/c7-6(8)5-3-1-2-4-9-5;/h2,4-5H,1,3H2,(H,7,8);/q;+1/p-1
