1677-80-1

Usage

Uses

Used in Pharmaceutical Industry:
3,4-dichloropyridazine serves as a key intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique chemical structure allows for the creation of diverse medicinal compounds with potential applications in treating various diseases and conditions.
Used in Pesticide Industry:
In the pesticide industry, 3,4-dichloropyridazine is utilized as an intermediate for the production of various agrochemicals. Its incorporation into these compounds can enhance their effectiveness in controlling pests and protecting crops, thereby contributing to increased agricultural productivity.
Used in Materials Science:
3,4-dichloropyridazine has found applications in the field of materials science due to its reactivity and versatile chemical properties. It can be used to develop new materials with specific properties, such as improved stability, enhanced reactivity, or tailored physical characteristics, depending on the desired application.
Used in Organic Synthesis:
As a versatile building block in organic synthesis, 3,4-dichloropyridazine is employed in the preparation of a wide range of organic compounds. Its unique structure allows for various chemical reactions, enabling the synthesis of complex molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
It is crucial to handle 3,4-dichloropyridazine with care, as it may pose health and environmental risks if not properly managed. Proper safety measures and disposal methods should be followed to minimize any potential hazards associated with its use.

InChI:InChI=1/C4H2Cl2N2/c5-3-1-2-7-8-4(3)6/h1-2H

Upstream product

• 1677-79-8 4-chloropyridazin-3-ol 
• 504-30-3 3-hydroxypyridazine 

Downstream Products

• 1490-44-4 3-chloro-6-phenoxy-pyridazine 
• 1415050-22-4 C₁₀H₈ClN₃O 

Relevant academic research and scientific papers

Thioacetic acid compounds. Composition and application thereof

The invention discloses a compound. The compound can be used for adjusting a uric acid level of a single or a combination of one or more tissues, organs, blood, sera and urine, and treating or preventing symptoms relating to the abnormal uric acid level.

Efficient Phosphorus-Free Chlorination of Hydroxy Aza-Arenes and Their Application in One-Pot Pharmaceutical Synthesis

The chlorination of hydroxy aza-arenes with bis(trichloromethyl) carbonate (BTC) and SOCl2 has been effectively performed by refluxing with 5 wt % 4-dimethylaminopyridine (DMAP) as a catalyst. Various substrates are chlorinated with high yields. The obtained chlorinated aza-arenes can be used directly with simple workup for succedent one-pot synthesis on a large scale.

A 3,4- [...] method for the synthesis of

The invention discloses a novel synthesis method of 3,4-dichloropyridazine. The 3,4-dichloropyridazine 4 is prepared through reaction between a compound 3 and POCl3 in an isopropanol solvent, the compound 3 is prepared through reaction between a compound 2 and MnO2 in a tetrahydrofuran solvent, and the compound 2 is prepared through reaction between a compound 1 and hydrazine hydrate in an acetonitrile solvent, wherein preferred conditions are as follows: a mol ratio of the hydrazine hydrate to the compound 1 is 1.1 to 1, the reaction temperature is 25-30 DEG C, the time is 6h; a mol ratio of MnO2 to the compound 2 is 4 to 1, the reaction temperature is 25 DEG C, the time is 8h; a mol ratio of the POCl3 to the compound 2 is 2.5 to 1, the reflowing reaction temperature is 80 DEG C, and the time is 3h. The synthesis method has the advantages that the raw materials are easily available, reaction conditions are mild, operability in post-treatment is good, the yield is relatively high, the production is easily enlarged, and thus the novel synthesis method is especially suitable for industrial large-scale production.