175204-32-7 Usage
Uses
Used in Disinfectant and Antiseptic Applications:
2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL is used as a disinfectant and antiseptic due to its antimicrobial properties. It effectively kills or inhibits the growth of a wide range of microorganisms, including bacteria, viruses, and fungi, making it suitable for use in healthcare settings, household cleaning products, and personal hygiene products.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL is used as a key intermediate in the synthesis of various drugs. Its unique chemical structure allows for the development of new compounds with potential therapeutic applications, such as antimicrobial, anti-inflammatory, and anticancer agents.
Used in Agricultural Chemicals:
2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL is also utilized in the synthesis of agricultural chemicals, such as pesticides and herbicides. Its antimicrobial properties can help control the growth of harmful microorganisms and pests in crops, thereby improving crop yield and quality.
Used in Water Treatment:
2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL has been studied for its potential use in controlling microbial growth in water systems. Its ability to inhibit the growth of microorganisms can help maintain water quality and prevent the spread of waterborne diseases in various settings, such as swimming pools, cooling towers, and industrial water systems.
Used as a Preservative in Personal Care Products:
In the personal care industry, 2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL is used as a preservative in various products, such as cosmetics, lotions, and creams. Its antimicrobial properties help prevent the growth of bacteria, fungi, and other microorganisms that can cause spoilage or contamination of these products, ensuring their safety and efficacy.
However, it is important to note that 2,6-DIBROMO-4-CHLORO-3,5-DIMETHYLPHENOL should be handled with caution due to its toxic and irritant nature. Proper safety measures, such as wearing protective gear and following recommended guidelines, should be taken to minimize potential health risks associated with its use.
Check Digit Verification of cas no
The CAS Registry Mumber 175204-32-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 4 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 175204-32:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*4)+(2*3)+(1*2)=117
117 % 10 = 7
So 175204-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Br2ClO/c1-3-5(9)8(12)6(10)4(2)7(3)11/h12H,1-2H3
