1763-27-5 Usage
Uses
Used in Chemical Synthesis:
Ethyl trifluorovinyl ether is used as a chemical intermediate in the production of fluorinated polymers, which are known for their unique properties such as high thermal stability, chemical resistance, and non-flammability. These polymers find applications in various industries, including aerospace, automotive, electronics, and medical.
Used in Organic Synthesis:
As a reagent in organic synthesis, ethyl trifluorovinyl ether plays a crucial role in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its unique reactivity allows for the formation of new chemical bonds and the modification of existing ones, enabling the creation of novel molecules with desired properties.
Used in Solvent Applications:
Ethyl trifluorovinyl ether is employed as a solvent for resins, waxes, and oils due to its ability to dissolve a wide range of substances. Its solvent properties make it useful in various industrial processes, such as the manufacturing of coatings, adhesives, and lubricants, where its ability to dissolve and disperse materials is essential for achieving desired product characteristics.
Used in Refrigeration Industry:
As a refrigerant, ethyl trifluorovinyl ether is utilized in refrigeration systems due to its low boiling point, high heat capacity, and non-toxic nature. It is particularly useful in applications where traditional refrigerants are not suitable or where a more environmentally friendly alternative is desired.
However, it is important to note that the use of ethyl trifluorovinyl ether in these applications must be carefully managed to minimize the risks associated with its high reactivity and potential to form explosive peroxides. Proper handling, storage, and disposal procedures should be followed to ensure the safety of workers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 1763-27-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,6 and 3 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 1763-27:
(6*1)+(5*7)+(4*6)+(3*3)+(2*2)+(1*7)=85
85 % 10 = 5
So 1763-27-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H5F3O/c1-2-8-4(7)3(5)6/h2H2,1H3
1763-27-5Relevant academic research and scientific papers
Influence of structural factors on the thermolysis of 2- alkoxytetrafluoropropionic acid salts
Zeyfman,Sterlin
experimental part, p. 657 - 659 (2011/02/17)
2,2,2-Trifluoroethyl and phenyl trifluorovinyl ethers were obtained by the thermolysis of 2-substituted potassium tetrafluoropropionates ROCF(CF 3)COOK (R = CF3CH2; Ph). The reaction mechanism is analyzed.
