19799-49-6 Usage
General Description
2,5-diphenylfuran-3,4-dicarboxylic acid is a chemical compound that belongs to the family of furanic compounds. It is a white crystalline solid with a molecular formula of C20H14O4. 2,5-diphenylfuran-3,4-dicarboxylic acid is primarily used as a building block in the synthesis of organic molecules and has potential applications in pharmaceuticals and materials science. Its unique structure and properties make it a valuable tool for chemical synthesis and research. Additionally, it may have potential uses in the development of new drugs or materials due to its diverse chemical reactivity and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 19799-49-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,9 and 9 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 19799-49:
(7*1)+(6*9)+(5*7)+(4*9)+(3*9)+(2*4)+(1*9)=176
176 % 10 = 6
So 19799-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H12O5/c19-17(20)13-14(18(21)22)16(12-9-5-2-6-10-12)23-15(13)11-7-3-1-4-8-11/h1-10H,(H,19,20)(H,21,22)
19799-49-6Relevant articles and documents
Therapeutic and diagnostic ligand systems comprising transport molecule binding properties and medicaments containing the same
-
, (2008/06/13)
The invention relates to transport molecule binding ligand compounds which comprise a therapeutically and/or diagnostically active substance and a carrier molecule-affine substance with a high association constant to the carrier molecule. The invention also relates to medicaments containing these ligand compounds and to diagnostic kits.