20033-99-2 Usage
Uses
Used in Pharmaceutical Industry:
(5-METHOXY-1H-BENZOIMIDAZOL-2-YL)-METHANOL is used as a potential antiviral and anticancer agent for its pharmacological effects. Its structure and functional groups suggest that it may have biological activity, making it a promising candidate for the development of new therapeutic agents.
Used in Chemical Synthesis:
(5-METHOXY-1H-BENZOIMIDAZOL-2-YL)-METHANOL is used as a building block for the synthesis of other drug candidates and chemical derivatives, contributing to the development of novel compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 20033-99-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,0,3 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 20033-99:
(7*2)+(6*0)+(5*0)+(4*3)+(3*3)+(2*9)+(1*9)=62
62 % 10 = 2
So 20033-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O2/c1-13-6-2-3-7-8(4-6)11-9(5-12)10-7/h2-4,12H,5H2,1H3,(H,10,11)
