2047-89-4 Usage
Uses
Used in Pharmaceutical Industry:
INDOLO(2,3-B)CYCLOHEPTENE is used as a pharmacological agent for its potential effects on the central nervous system. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs to treat neurological disorders and other conditions related to the central nervous system.
Used in Organic Chemistry Research:
INDOLO(2,3-B)CYCLOHEPTENE serves as a key compound in organic chemistry research, where its unique structure and properties are studied to understand its reactivity, synthesis, and potential applications in the creation of new organic compounds and materials.
Used in Drug Discovery and Development:
INDOLO(2,3-B)CYCLOHEPTENE is utilized as a drug target in the drug discovery and development process. Its unique interactions with biological systems make it a valuable starting point for designing new therapeutic agents that can modulate specific pathways or target particular receptors, offering novel treatment options for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 2047-89-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,4 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2047-89:
(6*2)+(5*0)+(4*4)+(3*7)+(2*8)+(1*9)=74
74 % 10 = 4
So 2047-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N/c1-2-6-10-11-7-4-5-9-13(11)14-12(10)8-3-1/h4-5,7,9,14H,1-3,6,8H2
2047-89-4Relevant academic research and scientific papers
Rodriguez, Gonzalo,Benito, Yolanda,Temprano, Fernando
, p. 427 - 428 (1985)
Attack of MeMgI and PhMgBr in toluene on spiro (1) in the presence of Cu2Cl2 gives 2'-substituted spiro in quantitative yields.Also, attack of PhCH2CH2MgBr on 1 in the presence of Cu2Cl2 afforded 2'-phenethyl, 2'-H and 2'-benzyl (or 2'-p-xylyl) derivatives in toluene (or p-xylene) as solvent.
