20737-41-1 Usage
General Description
4-Aminopyrimidine-5-carboxylic acid is a derivative of pyrimidine, containing an amino group and a carboxylic acid group. It is commonly used in the synthesis of pharmaceuticals and agrochemicals, acting as an important building block in the production of various drugs and compounds. The compound has been studied for its potential antifungal and antimicrobial properties, and it has been explored as a potential target for drug development. Additionally, 4-aminopyrimidine-5-carboxylic acid has been investigated for its role in metal coordination chemistry and as a ligand in the formation of metal complexes. Its versatile chemical properties make it a valuable compound in the field of organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 20737-41-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,7,3 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 20737-41:
(7*2)+(6*0)+(5*7)+(4*3)+(3*7)+(2*4)+(1*1)=91
91 % 10 = 1
So 20737-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N3O2/c6-4-3(5(9)10)1-7-2-8-4/h1-2H,(H,9,10)(H2,6,7,8)
