2157-39-3 Usage
Uses
Used in Pharmaceutical Industry:
5-Chloroisophthalic acid is used as a key intermediate for the synthesis of several pharmaceuticals. Its chemical structure allows for the creation of various drug molecules, making it a valuable component in the development of new medications.
Used in Dye Industry:
5-Chloroisophthalic acid is used as a raw material in the production of dyes. Its unique properties contribute to the color and stability of the dyes, making it an important component in the formulation of various colorants.
Used in Polymer Industry:
5-Chloroisophthalic acid is used as a monomer in the synthesis of polymers. Its presence in the polymer chain can influence the properties of the final product, such as strength, flexibility, and resistance to environmental factors.
Used in Chemical Research:
5-Chloroisophthalic acid is used as a research compound in various chemical studies. Its unique structure and properties make it an interesting subject for investigation, potentially leading to new discoveries and applications in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 2157-39-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,5 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 2157-39:
(6*2)+(5*1)+(4*5)+(3*7)+(2*3)+(1*9)=73
73 % 10 = 3
So 2157-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,(H,10,11)(H,12,13)
2157-39-3Relevant academic research and scientific papers
N-acetonylbenzamides and their use as fungicides
-
, (2008/06/13)
Certain N-acetonylbenzamides exhibit low phytotoxicity and are useful for control of a wide range of fungi, including phytopathogenic fungi of the classes Oomycetes, Ascomycetes, Deuteromycetes and Basidiomycetes.
