22123-14-4 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-6-methyl-4-(trifluoromethyl)pyridine is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine is utilized for its insecticidal and fungicidal properties, making it an essential ingredient in the formulation of effective pesticides. Its application helps in protecting crops from pests and diseases, thereby ensuring increased agricultural productivity.
Used in Organic Synthesis:
2-Chloro-6-methyl-4-(trifluoromethyl)pyridine is employed as a building block in organic synthesis for the creation of a wide range of organic compounds. Its reactivity and structural features make it a valuable component in the synthesis of complex organic molecules, contributing to the discovery of new chemical entities with potential applications in various fields.
Used in Chemical Research:
As a versatile chemical, 2-Chloro-6-methyl-4-(trifluoromethyl)pyridine is used in chemical research to explore its properties and potential applications. Its unique structure and reactivity provide opportunities for scientists to investigate new reactions and mechanisms, further expanding the understanding of organic chemistry and its practical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 22123-14-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,2,1,2 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 22123-14:
(7*2)+(6*2)+(5*1)+(4*2)+(3*3)+(2*1)+(1*4)=54
54 % 10 = 4
So 22123-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H4FNO/c8-5-1-2-7-6(3-5)9-4-10-7/h1-4H
