23562-52-9 Usage
Uses
Used in Pharmaceutical Industry:
N1-[2-(Acetylamino)-4,5-dichlorophenyl]acetamide is used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be incorporated into the development of new drugs with potential therapeutic benefits.
Used in Agrochemical Industry:
N1-[2-(ACETYLAMINO)-4,5-DICHLOROPHENYL]ACETAMIDE is also used in the production of agrochemicals, specifically as an active ingredient in the development of pesticides and herbicides. Its ability to control and eliminate pests and weeds contributes to increased crop yields and agricultural productivity.
Used as an Antibacterial Agent:
N1-[2-(Acetylamino)-4,5-dichlorophenyl]acetamide is known for its antibacterial properties, making it a valuable ingredient in the development of antimicrobial agents. It can be used to combat bacterial infections and promote overall health and hygiene.
Used as an Antifungal Agent:
In addition to its antibacterial properties, N1-[2-(ACETYLAMINO)-4,5-DICHLOROPHENYL]ACETAMIDE also exhibits antifungal activity. It can be incorporated into antifungal formulations to treat fungal infections and prevent the growth of mold and other fungi in various settings.
Used in Cancer Research and Treatment:
N1-[2-(Acetylamino)-4,5-dichlorophenyl]acetamide has been studied for its potential applications in the treatment of cancer. Its unique chemical structure may offer new avenues for the development of targeted therapies and the improvement of existing cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 23562-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,5,6 and 2 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23562-52:
(7*2)+(6*3)+(5*5)+(4*6)+(3*2)+(2*5)+(1*2)=99
99 % 10 = 9
So 23562-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H10Cl2N2O2/c1-5(15)13-9-3-7(11)8(12)4-10(9)14-6(2)16/h3-4H,1-2H3,(H,13,15)(H,14,16)
Xi:Irritant;
