23755-31-9 Usage
Uses
Used in Pharmaceutical Research:
N-(2-Hydroxy-cyclohexyl)-N-methyl-benzamide is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its unique structure allows for the creation of molecules with specific biological activities, making it a valuable asset in medicinal chemistry.
Used in Laboratory Research:
In the field of laboratory research, N-(2-Hydroxy-cyclohexyl)-N-methyl-benzamide is used as a building block for the synthesis of various pharmacologically active substances. Researchers leverage its chemical properties to explore its potential in creating new compounds with therapeutic benefits.
Used in Medical Applications:
N-(2-Hydroxy-cyclohexyl)-N-methyl-benzamide is being investigated for its therapeutic properties in various medical applications. Its potential role in regulating biological processes positions it as a candidate for further exploration in the development of treatments for specific diseases and conditions.
Used in Drug Development:
In the pharmaceutical industry, N-(2-Hydroxy-cyclohexyl)-N-methyl-benzamide is used as a component in drug development. Its unique structure and properties make it a promising candidate for the creation of novel drugs with potential applications in treating a range of health issues.
Check Digit Verification of cas no
The CAS Registry Mumber 23755-31-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,7,5 and 5 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 23755-31:
(7*2)+(6*3)+(5*7)+(4*5)+(3*5)+(2*3)+(1*1)=109
109 % 10 = 9
So 23755-31-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H19NO2/c1-15(12-9-5-6-10-13(12)16)14(17)11-7-3-2-4-8-11/h2-4,7-8,12-13,16H,5-6,9-10H2,1H3
