23821-92-3 Usage
Description
METHYL (2,4-DIPHENYLTHIAZOL-5-YL)ACETATE is a thiazole derivative with the molecular formula C14H13NO2S. It is a white to off-white solid with a melting point of approximately 140-145°C. This chemical compound is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its potential biological activities, such as antiviral, antimicrobial, and anti-inflammatory properties. It also serves as a building block in the development of various chemical and pharmaceutical products, making it a valuable chemical in the field of organic chemistry.
Uses
Used in Pharmaceutical Industry:
METHYL (2,4-DIPHENYLTHIAZOL-5-YL)ACETATE is used as an intermediate in the synthesis of various pharmaceuticals for its potential biological activities, such as antiviral, antimicrobial, and anti-inflammatory properties.
Used in Agrochemical Industry:
METHYL (2,4-DIPHENYLTHIAZOL-5-YL)ACETATE is used as a building block in the development of agrochemicals, contributing to the creation of effective products for agricultural applications.
Used in Organic Chemistry Research:
METHYL (2,4-DIPHENYLTHIAZOL-5-YL)ACETATE is used as a valuable chemical in the field of organic chemistry, aiding researchers in the development and synthesis of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 23821-92-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,8,2 and 1 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 23821-92:
(7*2)+(6*3)+(5*8)+(4*2)+(3*1)+(2*9)+(1*2)=103
103 % 10 = 3
So 23821-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C18H15NO2S/c1-21-16(20)12-15-17(13-8-4-2-5-9-13)19-18(22-15)14-10-6-3-7-11-14/h2-11H,12H2,1H3
