24552-27-0 Usage
Uses
Used in Scientific Research:
3-Chloropropionic acid phenyl ester is used as a research compound for various applications in the field of organic chemistry. Its unique structure and properties make it a valuable tool for studying chemical reactions and mechanisms.
Used in Organic Chemistry:
In the realm of organic chemistry, 3-Chloropropionic acid phenyl ester is used as a reagent or intermediate in the synthesis of various organic compounds. Its chloro group can be a useful functional group for further reactions, such as substitution or elimination reactions, making it a versatile building block in organic synthesis.
Used in Pharmaceutical Development:
3-Chloropropionic acid phenyl ester may also be used in the development of pharmaceuticals, as its structure could potentially be incorporated into drug molecules. Its properties and reactivity could be harnessed to create new drugs or improve the synthesis of existing ones, contributing to advancements in medicine.
Used in Chemical Education:
In educational settings, 3-Chloropropionic acid phenyl ester can be used as a teaching aid to demonstrate the principles of organic chemistry, such as functional group chemistry, reaction mechanisms, and the synthesis of complex molecules. It can provide students with hands-on experience and a deeper understanding of the subject matter.
Check Digit Verification of cas no
The CAS Registry Mumber 24552-27-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,5,5 and 2 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 24552-27:
(7*2)+(6*4)+(5*5)+(4*5)+(3*2)+(2*2)+(1*7)=100
100 % 10 = 0
So 24552-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClO2/c10-7-6-9(11)12-8-4-2-1-3-5-8/h1-5H,6-7H2
