2516-40-7 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-1,3-benzothiazole is used as a pharmaceutical intermediate for its ability to contribute to the synthesis of various drugs and medications. Its unique chemical properties allow it to be a key component in the development of new pharmaceuticals, potentially leading to advancements in the treatment of various medical conditions.
As a chemical intermediate, 2-Bromo-1,3-benzothiazole plays a crucial role in the production of different pharmaceutical compounds. Its versatility in chemical reactions and compatibility with other molecules make it an essential building block in the creation of new and improved medications.
Check Digit Verification of cas no
The CAS Registry Mumber 2516-40-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,1 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 2516-40:
(6*2)+(5*5)+(4*1)+(3*6)+(2*4)+(1*0)=67
67 % 10 = 7
So 2516-40-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrNS/c8-5-2-1-3-6-7(5)9-4-10-6/h1-4H
2516-40-7Relevant academic research and scientific papers
2-Heterocyclic-1,3-bis(1H-1,2,4-triazol-1-yl)-propan-2-ols as antifungal agents
-
, (2008/06/13)
Compounds of the formula STR1 wherein R is thienyl, mono-, di- and trihalothienyl, furyl, 2-benzothiazolyl, pyridyl or chloropyridyl and their pharmaceutically acceptable salts are useful agents for combating fungal infections in animals, including humans.
